C10H16N2O4 — CID 138750394
(2S,4R)-1-(2-aminoacetyl)-4-prop-2-enoxypyrrolidine-2-carboxylic acid (PubChem CID 138750394) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is (2S,4R)-1-(2-aminoacetyl)-4-prop-2-enoxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-(2-aminoacetyl)-4-prop-2-enoxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 138750394 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2S,4R)-1-(2-aminoacetyl)-4-prop-2-enoxypyrrolidine-2-carboxylic acid |
| SMILES | C=CCO[C@@H]1C[C@@H](C(=O)O)N(C(=O)CN)C1 |
| InChI | InChI=1S/C10H16N2O4/c1-2-3-16-7-4-8(10(14)15)12(6-7)9(13)5-11/h2,7-8H,1,3-6,11H2,(H,14,15)/t7-,8+/m1/s1 |
| InChIKey | UZQGVLBKFDOSPP-SFYZADRCSA-N |
| XLogP | -0.80 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|