C10H18INO4Si — CID 68759600
(2R,4S)-1-(2-iodoacetyl)-4-trimethylsilyloxypyrrolidine-2-carboxylic acid (PubChem CID 68759600) has the molecular formula C10H18INO4Si and a molecular weight of 371.25 g/mol. Its IUPAC name is (2R,4S)-1-(2-iodoacetyl)-4-trimethylsilyloxypyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-1-(2-iodoacetyl)-4-trimethylsilyloxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 68759600 |
| Molecular Formula | C10H18INO4Si |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | (2R,4S)-1-(2-iodoacetyl)-4-trimethylsilyloxypyrrolidine-2-carboxylic acid |
| SMILES | C[Si](C)(C)O[C@H]1C[C@H](C(=O)O)N(C(=O)CI)C1 |
| InChI | InChI=1S/C10H18INO4Si/c1-17(2,3)16-7-4-8(10(14)15)12(6-7)9(13)5-11/h7-8H,4-6H2,1-3H3,(H,14,15)/t7-,8+/m0/s1 |
| InChIKey | SQFULKAZGAVTOX-JGVFFNPUSA-N |
| XLogP | 1.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|