C13H24F3NO4Si2 — CID 620369
trimethylsilyl 1-(2,2,2-trifluoroacetyl)-4-trimethylsilyloxypyrrolidine-2-carboxylate (PubChem CID 620369) has the molecular formula C13H24F3NO4Si2 and a molecular weight of 371.50 g/mol. Its IUPAC name is trimethylsilyl 1-(2,2,2-trifluoroacetyl)-4-trimethylsilyloxypyrrolidine-2-carboxylate.
| Compound Name | trimethylsilyl 1-(2,2,2-trifluoroacetyl)-4-trimethylsilyloxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 620369 |
| Molecular Formula | C13H24F3NO4Si2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | trimethylsilyl 1-(2,2,2-trifluoroacetyl)-4-trimethylsilyloxypyrrolidine-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1CC(O[Si](C)(C)C)CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H24F3NO4Si2/c1-22(2,3)20-9-7-10(11(18)21-23(4,5)6)17(8-9)12(19)13(14,15)16/h9-10H,7-8H2,1-6H3 |
| InChIKey | QLNHQMUXTLVSSX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|