C10H16F3NO3Si — CID 22217354
trimethylsilyl (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate (PubChem CID 22217354) has the molecular formula C10H16F3NO3Si and a molecular weight of 283.32 g/mol. Its IUPAC name is trimethylsilyl (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate.
| Compound Name | trimethylsilyl (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22217354 |
| Molecular Formula | C10H16F3NO3Si |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | trimethylsilyl (2S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)[C@@H]1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3Si/c1-18(2,3)17-8(15)7-5-4-6-14(7)9(16)10(11,12)13/h7H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | MXCCXVYXGPJHBS-ZETCQYMHSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|