C17H22N2O6 — CID 118243652
1-[(4S)-4-amino-4-carboxybutanoyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid (PubChem CID 118243652) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-[(4S)-4-amino-4-carboxybutanoyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(4S)-4-amino-4-carboxybutanoyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118243652 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-[(4S)-4-amino-4-carboxybutanoyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid |
| SMILES | N[C@@H](CCC(=O)N1CC(OCc2ccccc2)CC1C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H22N2O6/c18-13(16(21)22)6-7-15(20)19-9-12(8-14(19)17(23)24)25-10-11-4-2-1-3-5-11/h1-5,12-14H,6-10,18H2,(H,21,22)(H,23,24)/t12?,13-,14?/m0/s1 |
| InChIKey | IWFBQIKODQEVCY-MOKVOYLWSA-N |
| XLogP | 0.45 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |