C23H25NO8 — CID 141020233
(2S,4S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid (PubChem CID 141020233) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is (2S,4S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141020233 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (2S,4S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid |
| SMILES | COc1cc(C(=O)C(=O)N2C[C@@H](OCc3ccccc3)C[C@H]2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C23H25NO8/c1-29-18-9-15(10-19(30-2)21(18)31-3)20(25)22(26)24-12-16(11-17(24)23(27)28)32-13-14-7-5-4-6-8-14/h4-10,16-17H,11-13H2,1-3H3,(H,27,28)/t16-,17-/m0/s1 |
| InChIKey | JLVRHPOAYRAGJO-IRXDYDNUSA-N |
| XLogP | 2.17 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|