C30H31NO8 — CID 21027758
(3-phenoxyphenyl)methyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate (PubChem CID 21027758) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 21027758 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | (3-phenoxyphenyl)methyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
| SMILES | COc1cc(C(=O)C(=O)N2CCCCC2C(=O)OCc2cccc(Oc3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H31NO8/c1-35-25-17-21(18-26(36-2)28(25)37-3)27(32)29(33)31-15-8-7-14-24(31)30(34)38-19-20-10-9-13-23(16-20)39-22-11-5-4-6-12-22/h4-6,9-13,16-18,24H,7-8,14-15,19H2,1-3H3 |
| InChIKey | SHFDRUNMTYYHLY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|