C27H35NO7 — CID 144808951
2-phenylmethoxyethyl (2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carboxylate (PubChem CID 144808951) has the molecular formula C27H35NO7 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-phenylmethoxyethyl (2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carboxylate.
| Compound Name | 2-phenylmethoxyethyl (2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 144808951 |
| Molecular Formula | C27H35NO7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 2-phenylmethoxyethyl (2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carboxylate |
| SMILES | COc1cc([C@H](C)C(=O)N2CCCC[C@H]2C(=O)OCCOCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H35NO7/c1-19(21-16-23(31-2)25(33-4)24(17-21)32-3)26(29)28-13-9-8-12-22(28)27(30)35-15-14-34-18-20-10-6-5-7-11-20/h5-7,10-11,16-17,19,22H,8-9,12-15,18H2,1-4H3/t19-,22-/m0/s1 |
| InChIKey | NLADLPRONREVII-UGKGYDQZSA-N |
| XLogP | 3.96 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|