C26H39NO8 — CID 176564445
3-(3,4,5-trimethoxyphenyl)propyl (2S)-1-[2-hydroxy-2-(1-hydroxycyclohexyl)acetyl]piperidine-2-carboxylate (PubChem CID 176564445) has the molecular formula C26H39NO8 and a molecular weight of 493.60 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)propyl (2S)-1-[2-hydroxy-2-(1-hydroxycyclohexyl)acetyl]piperidine-2-carboxylate.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)propyl (2S)-1-[2-hydroxy-2-(1-hydroxycyclohexyl)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 176564445 |
| Molecular Formula | C26H39NO8 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)propyl (2S)-1-[2-hydroxy-2-(1-hydroxycyclohexyl)acetyl]piperidine-2-carboxylate |
| SMILES | COc1cc(CCCOC(=O)[C@@H]2CCCCN2C(=O)C(O)C2(O)CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H39NO8/c1-32-20-16-18(17-21(33-2)22(20)34-3)10-9-15-35-25(30)19-11-5-8-14-27(19)24(29)23(28)26(31)12-6-4-7-13-26/h16-17,19,23,28,31H,4-15H2,1-3H3/t19-,23?/m0/s1 |
| InChIKey | VWERHWNYDYFNDV-HSTJUUNISA-N |
| XLogP | 2.63 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|