C29H43NO5 — CID 121368009
5-(3-methoxy-4,5-dimethylphenyl)pentyl 1-[2-(1-methylcyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 121368009) has the molecular formula C29H43NO5 and a molecular weight of 485.67 g/mol. Its IUPAC name is 5-(3-methoxy-4,5-dimethylphenyl)pentyl 1-[2-(1-methylcyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | 5-(3-methoxy-4,5-dimethylphenyl)pentyl 1-[2-(1-methylcyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 121368009 |
| Molecular Formula | C29H43NO5 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | 5-(3-methoxy-4,5-dimethylphenyl)pentyl 1-[2-(1-methylcyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | COc1cc(CCCCCOC(=O)C2CCCCN2C(=O)C(=O)C2(C)CCCCC2)cc(C)c1C |
| InChI | InChI=1S/C29H43NO5/c1-21-19-23(20-25(34-4)22(21)2)13-7-5-12-18-35-28(33)24-14-8-11-17-30(24)27(32)26(31)29(3)15-9-6-10-16-29/h19-20,24H,5-18H2,1-4H3 |
| InChIKey | PAQSJRUGQNZPII-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|