C26H37NO8 — CID 87056866
3-(3,4,5-trimethoxyphenyl)propyl 1-[2-(1-hydroxycyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 87056866) has the molecular formula C26H37NO8 and a molecular weight of 491.58 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)propyl 1-[2-(1-hydroxycyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)propyl 1-[2-(1-hydroxycyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 87056866 |
| Molecular Formula | C26H37NO8 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)propyl 1-[2-(1-hydroxycyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | COc1cc(CCCOC(=O)C2CCCCN2C(=O)C(=O)C2(O)CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H37NO8/c1-32-20-16-18(17-21(33-2)22(20)34-3)10-9-15-35-25(30)19-11-5-8-14-27(19)24(29)23(28)26(31)12-6-4-7-13-26/h16-17,19,31H,4-15H2,1-3H3 |
| InChIKey | MKRMETUYCIIZEF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|