C27H39NO5 — CID 121368003
3-(3-methoxy-4,5-dimethylphenyl)propyl 1-[2-(1-methylcyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 121368003) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is 3-(3-methoxy-4,5-dimethylphenyl)propyl 1-[2-(1-methylcyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | 3-(3-methoxy-4,5-dimethylphenyl)propyl 1-[2-(1-methylcyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 121368003 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 3-(3-methoxy-4,5-dimethylphenyl)propyl 1-[2-(1-methylcyclohexyl)-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | COc1cc(CCCOC(=O)C2CCCCN2C(=O)C(=O)C2(C)CCCCC2)cc(C)c1C |
| InChI | InChI=1S/C27H39NO5/c1-19-17-21(18-23(32-4)20(19)2)11-10-16-33-26(31)22-12-6-9-15-28(22)25(30)24(29)27(3)13-7-5-8-14-27/h17-18,22H,5-16H2,1-4H3 |
| InChIKey | JQRFAGFEZUWKPJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|