About molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate
molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate (PubChem CID 144759601) has the molecular formula C21H33NO5
and a molecular weight of 379.50 g/mol. Its IUPAC name is molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate.
Molecular Properties
| Compound Name | molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate |
| PubChem CID | 144759601 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate |
| SMILES | C=C(C)N1CCCCC1C(=O)OCCCc1cc(OC)c(OC)c(OC)c1.[H][H] |
| InChI | InChI=1S/C21H31NO5.H2/c1-15(2)22-11-7-6-10-17(22)21(23)27-12-8-9-16-13-18(24-3)20(26-5)19(14-16)25-4;/h13-14,17H,1,6-12H2,2-5H3;1H |
| InChIKey | ISSACPMNDWCCSY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate?
The IUPAC name of molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate (CID 144759601) is molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate.
What is the SMILES notation for molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate?
The canonical SMILES for molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate is C=C(C)N1CCCCC1C(=O)OCCCc1cc(OC)c(OC)c(OC)c1.[H][H].
What is the InChIKey of molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate?
The InChIKey is ISSACPMNDWCCSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31NO5.H2/c1-15(2)22-11-7-6-10-17(22)21(23)27-12-8-9-16-13-18(24-3)20(26-5)19(14-16)25-4;/h13-14,17H,1,6-12H2,2-5H3;1H.
What are the key properties of molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate?
molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate has a molecular weight of 379.50 g/mol, XLogP of 3.82, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;3-(3,4,5-trimethoxyphenyl)propyl 1-prop-1-en-2-ylpiperidine-2-carboxylate is sourced from PubChem (CID 144759601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).