C29H39NO7 — CID 21258249
4-(4-methoxyphenyl)butyl 1-[2-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carboxylate (PubChem CID 21258249) has the molecular formula C29H39NO7 and a molecular weight of 513.63 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)butyl 1-[2-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carboxylate.
| Compound Name | 4-(4-methoxyphenyl)butyl 1-[2-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 21258249 |
| Molecular Formula | C29H39NO7 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 4-(4-methoxyphenyl)butyl 1-[2-(3,4,5-trimethoxyphenyl)propanoyl]piperidine-2-carboxylate |
| SMILES | COc1ccc(CCCCOC(=O)C2CCCCN2C(=O)C(C)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H39NO7/c1-20(22-18-25(34-3)27(36-5)26(19-22)35-4)28(31)30-16-8-6-11-24(30)29(32)37-17-9-7-10-21-12-14-23(33-2)15-13-21/h12-15,18-20,24H,6-11,16-17H2,1-5H3 |
| InChIKey | QGNPZOFKSDNOHW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|