C27H35NO9 — CID 176564452
2-O-[3-(2,5-dimethoxyphenyl)propyl] 1-O-(3,4,5-trimethoxyphenyl) (2S)-piperidine-1,2-dicarboxylate (PubChem CID 176564452) has the molecular formula C27H35NO9 and a molecular weight of 517.58 g/mol. Its IUPAC name is 2-O-[3-(2,5-dimethoxyphenyl)propyl] 1-O-(3,4,5-trimethoxyphenyl) (2S)-piperidine-1,2-dicarboxylate.
| Compound Name | 2-O-[3-(2,5-dimethoxyphenyl)propyl] 1-O-(3,4,5-trimethoxyphenyl) (2S)-piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 176564452 |
| Molecular Formula | C27H35NO9 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 2-O-[3-(2,5-dimethoxyphenyl)propyl] 1-O-(3,4,5-trimethoxyphenyl) (2S)-piperidine-1,2-dicarboxylate |
| SMILES | COc1ccc(OC)c(CCCOC(=O)[C@@H]2CCCCN2C(=O)Oc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C27H35NO9/c1-31-19-11-12-22(32-2)18(15-19)9-8-14-36-26(29)21-10-6-7-13-28(21)27(30)37-20-16-23(33-3)25(35-5)24(17-20)34-4/h11-12,15-17,21H,6-10,13-14H2,1-5H3/t21-/m0/s1 |
| InChIKey | FZSNNWXXJPRILE-NRFANRHFSA-N |
| XLogP | 4.26 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|