C30H41NO10 — CID 176564446
4-(3,4,5-trimethoxyphenyl)butyl 1-[2-hydroxy-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate (PubChem CID 176564446) has the molecular formula C30H41NO10 and a molecular weight of 575.66 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenyl)butyl 1-[2-hydroxy-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate.
| Compound Name | 4-(3,4,5-trimethoxyphenyl)butyl 1-[2-hydroxy-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 176564446 |
| Molecular Formula | C30H41NO10 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenyl)butyl 1-[2-hydroxy-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
| SMILES | COc1cc(CCCCOC(=O)C2CCCCN2C(=O)C(O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H41NO10/c1-35-22-15-19(16-23(36-2)27(22)39-5)11-8-10-14-41-30(34)21-12-7-9-13-31(21)29(33)26(32)20-17-24(37-3)28(40-6)25(18-20)38-4/h15-18,21,26,32H,7-14H2,1-6H3 |
| InChIKey | HGAQGTLPYFMVAC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|