C17H25NO5 — CID 139386516
3-(3,4,5-trimethoxyphenyl)propyl pyrrolidine-2-carboxylate (PubChem CID 139386516) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)propyl pyrrolidine-2-carboxylate.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)propyl pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139386516 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)propyl pyrrolidine-2-carboxylate |
| SMILES | COc1cc(CCCOC(=O)C2CCCN2)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO5/c1-20-14-10-12(11-15(21-2)16(14)22-3)6-5-9-23-17(19)13-7-4-8-18-13/h10-11,13,18H,4-9H2,1-3H3 |
| InChIKey | OSCNBIPRNWBXGF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|