C17H23NO6 — CID 23224708
[2-(3,4,5-trimethoxyphenyl)acetyl] piperidine-2-carboxylate (PubChem CID 23224708) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is [2-(3,4,5-trimethoxyphenyl)acetyl] piperidine-2-carboxylate.
| Compound Name | [2-(3,4,5-trimethoxyphenyl)acetyl] piperidine-2-carboxylate |
|---|---|
| PubChem CID | 23224708 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-(3,4,5-trimethoxyphenyl)acetyl] piperidine-2-carboxylate |
| SMILES | COc1cc(CC(=O)OC(=O)C2CCCCN2)cc(OC)c1OC |
| InChI | InChI=1S/C17H23NO6/c1-21-13-8-11(9-14(22-2)16(13)23-3)10-15(19)24-17(20)12-6-4-5-7-18-12/h8-9,12,18H,4-7,10H2,1-3H3 |
| InChIKey | CUIZCJPANDIYMN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|