C22H28O6 — CID 11292180
3-(4-methoxyphenyl)propyl 3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 11292180) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)propyl 3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | 3-(4-methoxyphenyl)propyl 3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 11292180 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-(4-methoxyphenyl)propyl 3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | COc1ccc(CCCOC(=O)CCc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H28O6/c1-24-18-10-7-16(8-11-18)6-5-13-28-21(23)12-9-17-14-19(25-2)22(27-4)20(15-17)26-3/h7-8,10-11,14-15H,5-6,9,12-13H2,1-4H3 |
| InChIKey | KSUMPTMHFIGKTO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|