C22H22O5 — CID 2677389
naphthalen-2-yl 3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 2677389) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is naphthalen-2-yl 3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | naphthalen-2-yl 3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 2677389 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | naphthalen-2-yl 3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | COc1cc(CCC(=O)Oc2ccc3ccccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22O5/c1-24-19-12-15(13-20(25-2)22(19)26-3)8-11-21(23)27-18-10-9-16-6-4-5-7-17(16)14-18/h4-7,9-10,12-14H,8,11H2,1-3H3 |
| InChIKey | YQPCTUKWTGQJEW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|