About naphthalen-2-yl 3-sulfanylpropanoate
naphthalen-2-yl 3-sulfanylpropanoate (PubChem CID 169079274) has the molecular formula C13H12O2S
and a molecular weight of 232.30 g/mol. Its IUPAC name is naphthalen-2-yl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | naphthalen-2-yl 3-sulfanylpropanoate |
| PubChem CID | 169079274 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | naphthalen-2-yl 3-sulfanylpropanoate |
| SMILES | O=C(CCS)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H12O2S/c14-13(7-8-16)15-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,16H,7-8H2 |
| InChIKey | AMJSFIVRHVWLDY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-yl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl 3-sulfanylpropanoate?
The IUPAC name of naphthalen-2-yl 3-sulfanylpropanoate (CID 169079274) is naphthalen-2-yl 3-sulfanylpropanoate.
What is the SMILES notation for naphthalen-2-yl 3-sulfanylpropanoate?
The canonical SMILES for naphthalen-2-yl 3-sulfanylpropanoate is O=C(CCS)Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-yl 3-sulfanylpropanoate?
The InChIKey is AMJSFIVRHVWLDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2S/c14-13(7-8-16)15-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,16H,7-8H2.
What are the key properties of naphthalen-2-yl 3-sulfanylpropanoate?
naphthalen-2-yl 3-sulfanylpropanoate has a molecular weight of 232.30 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl 3-sulfanylpropanoate is sourced from PubChem (CID 169079274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).