About naphthalen-2-yl 2-nitroacetate
naphthalen-2-yl 2-nitroacetate (PubChem CID 139660327) has the molecular formula C12H9NO4
and a molecular weight of 231.21 g/mol. Its IUPAC name is naphthalen-2-yl 2-nitroacetate.
Molecular Properties
| Compound Name | naphthalen-2-yl 2-nitroacetate |
| PubChem CID | 139660327 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | naphthalen-2-yl 2-nitroacetate |
| SMILES | O=C(C[N+](=O)[O-])Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H9NO4/c14-12(8-13(15)16)17-11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| InChIKey | KBKALMZKOIGHHO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-yl 2-nitroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl 2-nitroacetate?
The IUPAC name of naphthalen-2-yl 2-nitroacetate (CID 139660327) is naphthalen-2-yl 2-nitroacetate.
What is the SMILES notation for naphthalen-2-yl 2-nitroacetate?
The canonical SMILES for naphthalen-2-yl 2-nitroacetate is O=C(C[N+](=O)[O-])Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-yl 2-nitroacetate?
The InChIKey is KBKALMZKOIGHHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c14-12(8-13(15)16)17-11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2.
What are the key properties of naphthalen-2-yl 2-nitroacetate?
naphthalen-2-yl 2-nitroacetate has a molecular weight of 231.21 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl 2-nitroacetate is sourced from PubChem (CID 139660327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).