C48H36O12 — CID 139091149
dinaphthalen-2-yl (2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 139091149) has the molecular formula C48H36O12 and a molecular weight of 804.80 g/mol. Its IUPAC name is dinaphthalen-2-yl (2R,3R)-2,3-dihydroxybutanedioate.
| Compound Name | dinaphthalen-2-yl (2R,3R)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 139091149 |
| Molecular Formula | C48H36O12 |
| Molecular Weight | 804.80 g/mol |
| Exact Mass | 804.22 |
| IUPAC Name | dinaphthalen-2-yl (2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | O=C(Oc1ccc2ccccc2c1)[C@H](O)[C@@H](O)C(=O)Oc1ccc2ccccc2c1.O=C(Oc1ccc2ccccc2c1)[C@H](O)[C@@H](O)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/2C24H18O6/c2*25-21(23(27)29-19-11-9-15-5-1-3-7-17(15)13-19)22(26)24(28)30-20-12-10-16-6-2-4-8-18(16)14-20/h2*1-14,21-22,25-26H/t2*21-,22-/m11/s1 |
| InChIKey | RKDORAGEDZFKSI-WPBPUIOYSA-N |
| XLogP | 6.45 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.80 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|