C18H18O8 — CID 89106310
bis(4-methoxyphenyl) (2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 89106310) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is bis(4-methoxyphenyl) (2R,3R)-2,3-dihydroxybutanedioate.
| Compound Name | bis(4-methoxyphenyl) (2R,3R)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 89106310 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | bis(4-methoxyphenyl) (2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | COc1ccc(OC(=O)[C@H](O)[C@@H](O)C(=O)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H18O8/c1-23-11-3-7-13(8-4-11)25-17(21)15(19)16(20)18(22)26-14-9-5-12(24-2)6-10-14/h3-10,15-16,19-20H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | UGCBRAGPUQCKPZ-HZPDHXFCSA-N |
| XLogP | 0.94 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|