C18H26O14 — CID 67241631
[4-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyphenyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 67241631) has the molecular formula C18H26O14 and a molecular weight of 466.39 g/mol. Its IUPAC name is [4-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyphenyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [4-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyphenyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 67241631 |
| Molecular Formula | C18H26O14 |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [4-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyphenyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C(Oc1ccc(OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H26O14/c19-5-9(21)11(23)13(25)15(27)17(29)31-7-1-2-8(4-3-7)32-18(30)16(28)14(26)12(24)10(22)6-20/h1-4,9-16,19-28H,5-6H2/t9-,10-,11-,12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | CYDVKJAAXWRUEZ-KJCFRMDSSA-N |
| XLogP | -5.63 |
| TPSA | 254.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | -5.63 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|