C13H17NO8 — CID 175427667
[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] 4-aminobenzoate (PubChem CID 175427667) has the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] 4-aminobenzoate.
| Compound Name | [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 175427667 |
| Molecular Formula | C13H17NO8 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C13H17NO8/c14-7-3-1-6(2-4-7)12(20)22-13(21)11(19)10(18)9(17)8(16)5-15/h1-4,8-11,15-19H,5,14H2/t8-,9-,10+,11-/m1/s1 |
| InChIKey | MULRSTXXGMMMOD-CHWFTXMASA-N |
| XLogP | -2.61 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|