C7H13NaO7S2 — CID 173307114
sodium;hydride;[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxymethanedithioic acid (PubChem CID 173307114) has the molecular formula C7H13NaO7S2 and a molecular weight of 296.30 g/mol. Its IUPAC name is sodium;hydride;[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxymethanedithioic acid.
| Compound Name | sodium;hydride;[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxymethanedithioic acid |
|---|---|
| PubChem CID | 173307114 |
| Molecular Formula | C7H13NaO7S2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | sodium;hydride;[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxymethanedithioic acid |
| SMILES | O=C(OC(=S)S)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H-].[Na+] |
| InChI | InChI=1S/C7H12O7S2.Na.H/c8-1-2(9)3(10)4(11)5(12)6(13)14-7(15)16;;/h2-5,8-12H,1H2,(H,15,16);;/q;+1;-1/t2-,3-,4+,5-;;/m1../s1 |
| InChIKey | BYGPNCMLZUWCPX-ZBHRUSISSA-N |
| XLogP | -5.70 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | -5.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|