About bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate
bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate (PubChem CID 142461311) has the molecular formula C22H16Cl2O5
and a molecular weight of 431.27 g/mol. Its IUPAC name is bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate.
Molecular Properties
| Compound Name | bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate |
| PubChem CID | 142461311 |
| Molecular Formula | C22H16Cl2O5 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate |
| SMILES | COc1ccc(C(C(=O)Oc2ccc(Cl)cc2)C(=O)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H16Cl2O5/c1-27-17-8-2-14(3-9-17)20(21(25)28-18-10-4-15(23)5-11-18)22(26)29-19-12-6-16(24)7-13-19/h2-13,20H,1H3 |
| InChIKey | PYLCTIMEVDWREL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate?
The IUPAC name of bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate (CID 142461311) is bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate.
What is the SMILES notation for bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate?
The canonical SMILES for bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate is COc1ccc(C(C(=O)Oc2ccc(Cl)cc2)C(=O)Oc2ccc(Cl)cc2)cc1.
What is the InChIKey of bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate?
The InChIKey is PYLCTIMEVDWREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl2O5/c1-27-17-8-2-14(3-9-17)20(21(25)28-18-10-4-15(23)5-11-18)22(26)29-19-12-6-16(24)7-13-19/h2-13,20H,1H3.
What are the key properties of bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate?
bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate has a molecular weight of 431.27 g/mol, XLogP of 5.30, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chlorophenyl) 2-(4-methoxyphenyl)propanedioate is sourced from PubChem (CID 142461311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).