About naphthalen-2-yl trichloromethyl carbonate
naphthalen-2-yl trichloromethyl carbonate (PubChem CID 141321648) has the molecular formula C12H7Cl3O3
and a molecular weight of 305.54 g/mol. Its IUPAC name is naphthalen-2-yl trichloromethyl carbonate.
Molecular Properties
| Compound Name | naphthalen-2-yl trichloromethyl carbonate |
| PubChem CID | 141321648 |
| Molecular Formula | C12H7Cl3O3 |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | naphthalen-2-yl trichloromethyl carbonate |
| SMILES | O=C(Oc1ccc2ccccc2c1)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H7Cl3O3/c13-12(14,15)18-11(16)17-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | MWSOFPBZQWDZNY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-yl trichloromethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl trichloromethyl carbonate?
The IUPAC name of naphthalen-2-yl trichloromethyl carbonate (CID 141321648) is naphthalen-2-yl trichloromethyl carbonate.
What is the SMILES notation for naphthalen-2-yl trichloromethyl carbonate?
The canonical SMILES for naphthalen-2-yl trichloromethyl carbonate is O=C(Oc1ccc2ccccc2c1)OC(Cl)(Cl)Cl.
What is the InChIKey of naphthalen-2-yl trichloromethyl carbonate?
The InChIKey is MWSOFPBZQWDZNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl3O3/c13-12(14,15)18-11(16)17-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H.
What are the key properties of naphthalen-2-yl trichloromethyl carbonate?
naphthalen-2-yl trichloromethyl carbonate has a molecular weight of 305.54 g/mol, XLogP of 4.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl trichloromethyl carbonate is sourced from PubChem (CID 141321648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).