About bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid
bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid (PubChem CID 174756889) has the molecular formula C91H62O9
and a molecular weight of 1299.49 g/mol. Its IUPAC name is bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid.
Molecular Properties
| Compound Name | bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid |
| PubChem CID | 174756889 |
| Molecular Formula | C91H62O9 |
| Molecular Weight | 1299.49 g/mol |
| Exact Mass | 1298.44 |
| IUPAC Name | bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid |
| SMILES | O=C(O)O.O=C(Oc1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc1)Oc1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc1.O=C(Oc1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc1)Oc1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/2C45H30O3.CH2O3/c2*46-45(47-43-25-21-35(22-26-43)33-9-13-37(14-10-33)41-19-17-31-5-1-3-7-39(31)29-41)48-44-27-23-36(24-28-44)34-11-15-38(16-12-34)42-20-18-32-6-2-4-8-40(32)30-42;2-1(3)4/h2*1-30H;(H2,2,3,4) |
| InChIKey | URFHMZSRGUARNV-UHFFFAOYSA-N |
| XLogP | 24.70 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 100 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1299.49 |
| LogP ≤ 5 | 24.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid?
The IUPAC name of bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid (CID 174756889) is bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid.
What is the SMILES notation for bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid?
The canonical SMILES for bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid is O=C(O)O.O=C(Oc1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc1)Oc1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc1.O=C(Oc1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc1)Oc1ccc(-c2ccc(-c3ccc4ccccc4c3)cc2)cc1.
What is the InChIKey of bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid?
The InChIKey is URFHMZSRGUARNV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C45H30O3.CH2O3/c2*46-45(47-43-25-21-35(22-26-43)33-9-13-37(14-10-33)41-19-17-31-5-1-3-7-39(31)29-41)48-44-27-23-36(24-28-44)34-11-15-38(16-12-34)42-20-18-32-6-2-4-8-40(32)30-42;2-1(3)4/h2*1-30H;(H2,2,3,4).
What are the key properties of bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid?
bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid has a molecular weight of 1299.49 g/mol, XLogP of 24.70, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis[4-(4-naphthalen-2-ylphenyl)phenyl] carbonate);carbonic acid is sourced from PubChem (CID 174756889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).