About carbonic acid;naphthalene
carbonic acid;naphthalene (PubChem CID 23113462) has the molecular formula C12H12O6
and a molecular weight of 252.22 g/mol. Its IUPAC name is carbonic acid;naphthalene.
Molecular Properties
| Compound Name | carbonic acid;naphthalene |
| PubChem CID | 23113462 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | carbonic acid;naphthalene |
| SMILES | O=C(O)O.O=C(O)O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2CH2O3/c1-2-6-10-8-4-3-7-9(10)5-1;2*2-1(3)4/h1-8H;2*(H2,2,3,4) |
| InChIKey | OCIWXMRDXZCSRH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbonic acid;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;naphthalene?
The IUPAC name of carbonic acid;naphthalene (CID 23113462) is carbonic acid;naphthalene.
What is the SMILES notation for carbonic acid;naphthalene?
The canonical SMILES for carbonic acid;naphthalene is O=C(O)O.O=C(O)O.c1ccc2ccccc2c1.
What is the InChIKey of carbonic acid;naphthalene?
The InChIKey is OCIWXMRDXZCSRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.2CH2O3/c1-2-6-10-8-4-3-7-9(10)5-1;2*2-1(3)4/h1-8H;2*(H2,2,3,4).
What are the key properties of carbonic acid;naphthalene?
carbonic acid;naphthalene has a molecular weight of 252.22 g/mol, XLogP of 3.28, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;naphthalene is sourced from PubChem (CID 23113462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).