About naphthalene;2-sulfanylprop-2-enoic acid
naphthalene;2-sulfanylprop-2-enoic acid (PubChem CID 174922746) has the molecular formula C13H12O2S
and a molecular weight of 232.30 g/mol. Its IUPAC name is naphthalene;2-sulfanylprop-2-enoic acid.
Molecular Properties
| Compound Name | naphthalene;2-sulfanylprop-2-enoic acid |
| PubChem CID | 174922746 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | naphthalene;2-sulfanylprop-2-enoic acid |
| SMILES | C=C(S)C(=O)O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C3H4O2S/c1-2-6-10-8-4-3-7-9(10)5-1;1-2(6)3(4)5/h1-8H;6H,1H2,(H,4,5) |
| InChIKey | ITTGKDNPESIDLX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalene;2-sulfanylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;2-sulfanylprop-2-enoic acid?
The IUPAC name of naphthalene;2-sulfanylprop-2-enoic acid (CID 174922746) is naphthalene;2-sulfanylprop-2-enoic acid.
What is the SMILES notation for naphthalene;2-sulfanylprop-2-enoic acid?
The canonical SMILES for naphthalene;2-sulfanylprop-2-enoic acid is C=C(S)C(=O)O.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;2-sulfanylprop-2-enoic acid?
The InChIKey is ITTGKDNPESIDLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C3H4O2S/c1-2-6-10-8-4-3-7-9(10)5-1;1-2(6)3(4)5/h1-8H;6H,1H2,(H,4,5).
What are the key properties of naphthalene;2-sulfanylprop-2-enoic acid?
naphthalene;2-sulfanylprop-2-enoic acid has a molecular weight of 232.30 g/mol, XLogP of 3.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;2-sulfanylprop-2-enoic acid is sourced from PubChem (CID 174922746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).