About benzo[f]azulene
benzo[f]azulene (PubChem CID 13065869) has the molecular formula C14H10
and a molecular weight of 178.23 g/mol. Its IUPAC name is benzo[f]azulene.
Molecular Properties
| Compound Name | benzo[f]azulene |
| PubChem CID | 13065869 |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | benzo[f]azulene |
| SMILES | c1cc2ccc3ccccc3cc-2c1 |
| InChI | InChI=1S/C14H10/c1-2-5-13-10-14-7-3-6-12(14)9-8-11(13)4-1/h1-10H |
| InChIKey | NCDGLWDTYSURSA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzo[f]azulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[f]azulene?
The IUPAC name of benzo[f]azulene (CID 13065869) is benzo[f]azulene.
What is the SMILES notation for benzo[f]azulene?
The canonical SMILES for benzo[f]azulene is c1cc2ccc3ccccc3cc-2c1.
What is the InChIKey of benzo[f]azulene?
The InChIKey is NCDGLWDTYSURSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10/c1-2-5-13-10-14-7-3-6-12(14)9-8-11(13)4-1/h1-10H.
What are the key properties of benzo[f]azulene?
benzo[f]azulene has a molecular weight of 178.23 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[f]azulene is sourced from PubChem (CID 13065869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).