About naphthalen-2-yl nitrate
naphthalen-2-yl nitrate (PubChem CID 13161391) has the molecular formula C10H7NO3
and a molecular weight of 189.17 g/mol. Its IUPAC name is naphthalen-2-yl nitrate.
Molecular Properties
| Compound Name | naphthalen-2-yl nitrate |
| PubChem CID | 13161391 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | naphthalen-2-yl nitrate |
| SMILES | O=[N+]([O-])Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H7NO3/c12-11(13)14-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | ZORDTEILMAWXLV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-yl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl nitrate?
The IUPAC name of naphthalen-2-yl nitrate (CID 13161391) is naphthalen-2-yl nitrate.
What is the SMILES notation for naphthalen-2-yl nitrate?
The canonical SMILES for naphthalen-2-yl nitrate is O=[N+]([O-])Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-yl nitrate?
The InChIKey is ZORDTEILMAWXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3/c12-11(13)14-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H.
What are the key properties of naphthalen-2-yl nitrate?
naphthalen-2-yl nitrate has a molecular weight of 189.17 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl nitrate is sourced from PubChem (CID 13161391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).