About phenyl nitrate;hydrate
phenyl nitrate;hydrate (PubChem CID 175136027) has the molecular formula C6H7NO4
and a molecular weight of 157.12 g/mol. Its IUPAC name is phenyl nitrate;hydrate.
Molecular Properties
| Compound Name | phenyl nitrate;hydrate |
| PubChem CID | 175136027 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | phenyl nitrate;hydrate |
| SMILES | O.O=[N+]([O-])Oc1ccccc1 |
| InChI | InChI=1S/C6H5NO3.H2O/c8-7(9)10-6-4-2-1-3-5-6;/h1-5H;1H2 |
| InChIKey | SNRKCEUUDVXPIK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenyl nitrate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl nitrate;hydrate?
The IUPAC name of phenyl nitrate;hydrate (CID 175136027) is phenyl nitrate;hydrate.
What is the SMILES notation for phenyl nitrate;hydrate?
The canonical SMILES for phenyl nitrate;hydrate is O.O=[N+]([O-])Oc1ccccc1.
What is the InChIKey of phenyl nitrate;hydrate?
The InChIKey is SNRKCEUUDVXPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.H2O/c8-7(9)10-6-4-2-1-3-5-6;/h1-5H;1H2.
What are the key properties of phenyl nitrate;hydrate?
phenyl nitrate;hydrate has a molecular weight of 157.12 g/mol, XLogP of 0.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl nitrate;hydrate is sourced from PubChem (CID 175136027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).