About guanidine;pyridin-3-yl nitrate
guanidine;pyridin-3-yl nitrate (PubChem CID 173434009) has the molecular formula C6H9N5O3
and a molecular weight of 199.17 g/mol. Its IUPAC name is guanidine;pyridin-3-yl nitrate.
Molecular Properties
| Compound Name | guanidine;pyridin-3-yl nitrate |
| PubChem CID | 173434009 |
| Molecular Formula | C6H9N5O3 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | guanidine;pyridin-3-yl nitrate |
| SMILES | O=[N+]([O-])Oc1cccnc1.[H]N=C(N)N |
| InChI | InChI=1S/C5H4N2O3.CH5N3/c8-7(9)10-5-2-1-3-6-4-5;2-1(3)4/h1-4H;(H5,2,3,4) |
| InChIKey | OKVXVYJBLAOTQP-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 141.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze guanidine;pyridin-3-yl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;pyridin-3-yl nitrate?
The IUPAC name of guanidine;pyridin-3-yl nitrate (CID 173434009) is guanidine;pyridin-3-yl nitrate.
What is the SMILES notation for guanidine;pyridin-3-yl nitrate?
The canonical SMILES for guanidine;pyridin-3-yl nitrate is O=[N+]([O-])Oc1cccnc1.[H]N=C(N)N.
What is the InChIKey of guanidine;pyridin-3-yl nitrate?
The InChIKey is OKVXVYJBLAOTQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3.CH5N3/c8-7(9)10-5-2-1-3-6-4-5;2-1(3)4/h1-4H;(H5,2,3,4).
What are the key properties of guanidine;pyridin-3-yl nitrate?
guanidine;pyridin-3-yl nitrate has a molecular weight of 199.17 g/mol, XLogP of -0.51, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;pyridin-3-yl nitrate is sourced from PubChem (CID 173434009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).