About ethane-1,2-diamine;3-nitropyridine
ethane-1,2-diamine;3-nitropyridine (PubChem CID 142993055) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is ethane-1,2-diamine;3-nitropyridine.
Molecular Properties
| Compound Name | ethane-1,2-diamine;3-nitropyridine |
| PubChem CID | 142993055 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | ethane-1,2-diamine;3-nitropyridine |
| SMILES | NCCN.O=[N+]([O-])c1cccnc1 |
| InChI | InChI=1S/C5H4N2O2.C2H8N2/c8-7(9)5-2-1-3-6-4-5;3-1-2-4/h1-4H;1-4H2 |
| InChIKey | LXGGVMSQHVAIHI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diamine;3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diamine;3-nitropyridine?
The IUPAC name of ethane-1,2-diamine;3-nitropyridine (CID 142993055) is ethane-1,2-diamine;3-nitropyridine.
What is the SMILES notation for ethane-1,2-diamine;3-nitropyridine?
The canonical SMILES for ethane-1,2-diamine;3-nitropyridine is NCCN.O=[N+]([O-])c1cccnc1.
What is the InChIKey of ethane-1,2-diamine;3-nitropyridine?
The InChIKey is LXGGVMSQHVAIHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.C2H8N2/c8-7(9)5-2-1-3-6-4-5;3-1-2-4/h1-4H;1-4H2.
What are the key properties of ethane-1,2-diamine;3-nitropyridine?
ethane-1,2-diamine;3-nitropyridine has a molecular weight of 184.20 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diamine;3-nitropyridine is sourced from PubChem (CID 142993055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).