About formaldehyde;3-nitropyridine
formaldehyde;3-nitropyridine (PubChem CID 159977951) has the molecular formula C6H6N2O3
and a molecular weight of 154.12 g/mol. Its IUPAC name is formaldehyde;3-nitropyridine.
Molecular Properties
| Compound Name | formaldehyde;3-nitropyridine |
| PubChem CID | 159977951 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | formaldehyde;3-nitropyridine |
| SMILES | C=O.O=[N+]([O-])c1cccnc1 |
| InChI | InChI=1S/C5H4N2O2.CH2O/c8-7(9)5-2-1-3-6-4-5;1-2/h1-4H;1H2 |
| InChIKey | OFJXWBXPHXWHFS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;3-nitropyridine?
The IUPAC name of formaldehyde;3-nitropyridine (CID 159977951) is formaldehyde;3-nitropyridine.
What is the SMILES notation for formaldehyde;3-nitropyridine?
The canonical SMILES for formaldehyde;3-nitropyridine is C=O.O=[N+]([O-])c1cccnc1.
What is the InChIKey of formaldehyde;3-nitropyridine?
The InChIKey is OFJXWBXPHXWHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.CH2O/c8-7(9)5-2-1-3-6-4-5;1-2/h1-4H;1H2.
What are the key properties of formaldehyde;3-nitropyridine?
formaldehyde;3-nitropyridine has a molecular weight of 154.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;3-nitropyridine is sourced from PubChem (CID 159977951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).