C16H20N4O5 — CID 161167094
2,3-dimethoxy-1H-cinnoline;methanol;3-nitropyridine (PubChem CID 161167094) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2,3-dimethoxy-1H-cinnoline;methanol;3-nitropyridine.
| Compound Name | 2,3-dimethoxy-1H-cinnoline;methanol;3-nitropyridine |
|---|---|
| PubChem CID | 161167094 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2,3-dimethoxy-1H-cinnoline;methanol;3-nitropyridine |
| SMILES | CO.COC1=Cc2ccccc2NN1OC.O=[N+]([O-])c1cccnc1 |
| InChI | InChI=1S/C10H12N2O2.C5H4N2O2.CH4O/c1-13-10-7-8-5-3-4-6-9(8)11-12(10)14-2;8-7(9)5-2-1-3-6-4-5;1-2/h3-7,11H,1-2H3;1-4H;2H,1H3 |
| InChIKey | UQRMCXPIYZFNIX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|