About 4-nitropyridine;hydrate
4-nitropyridine;hydrate (PubChem CID 132647818) has the molecular formula C5H6N2O3
and a molecular weight of 142.11 g/mol. Its IUPAC name is 4-nitropyridine;hydrate.
Molecular Properties
| Compound Name | 4-nitropyridine;hydrate |
| PubChem CID | 132647818 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 4-nitropyridine;hydrate |
| SMILES | O.O=[N+]([O-])c1ccncc1 |
| InChI | InChI=1S/C5H4N2O2.H2O/c8-7(9)5-1-3-6-4-2-5;/h1-4H;1H2 |
| InChIKey | ALRHVFAYUIVZON-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitropyridine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitropyridine;hydrate?
The IUPAC name of 4-nitropyridine;hydrate (CID 132647818) is 4-nitropyridine;hydrate.
What is the SMILES notation for 4-nitropyridine;hydrate?
The canonical SMILES for 4-nitropyridine;hydrate is O.O=[N+]([O-])c1ccncc1.
What is the InChIKey of 4-nitropyridine;hydrate?
The InChIKey is ALRHVFAYUIVZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.H2O/c8-7(9)5-1-3-6-4-2-5;/h1-4H;1H2.
What are the key properties of 4-nitropyridine;hydrate?
4-nitropyridine;hydrate has a molecular weight of 142.11 g/mol, XLogP of 0.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitropyridine;hydrate is sourced from PubChem (CID 132647818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).