About sodium;4-nitrophenolate;dihydrate
sodium;4-nitrophenolate;dihydrate (PubChem CID 2735104) has the molecular formula C6H8NNaO5
and a molecular weight of 197.12 g/mol. Its IUPAC name is sodium;4-nitrophenolate;dihydrate.
Molecular Properties
| Compound Name | sodium;4-nitrophenolate;dihydrate |
| PubChem CID | 2735104 |
| Molecular Formula | C6H8NNaO5 |
| Molecular Weight | 197.12 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | sodium;4-nitrophenolate;dihydrate |
| SMILES | O.O.O=[N+]([O-])c1ccc([O-])cc1.[Na+] |
| InChI | InChI=1S/C6H5NO3.Na.2H2O/c8-6-3-1-5(2-4-6)7(9)10;;;/h1-4,8H;;2*1H2/q;+1;;/p-1 |
| InChIKey | ZJYUDTPVWWBKPV-UHFFFAOYSA-M |
| XLogP | -3.98 |
| TPSA | 129.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.12 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-nitrophenolate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-nitrophenolate;dihydrate?
The IUPAC name of sodium;4-nitrophenolate;dihydrate (CID 2735104) is sodium;4-nitrophenolate;dihydrate.
What is the SMILES notation for sodium;4-nitrophenolate;dihydrate?
The canonical SMILES for sodium;4-nitrophenolate;dihydrate is O.O.O=[N+]([O-])c1ccc([O-])cc1.[Na+].
What is the InChIKey of sodium;4-nitrophenolate;dihydrate?
The InChIKey is ZJYUDTPVWWBKPV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO3.Na.2H2O/c8-6-3-1-5(2-4-6)7(9)10;;;/h1-4,8H;;2*1H2/q;+1;;/p-1.
What are the key properties of sodium;4-nitrophenolate;dihydrate?
sodium;4-nitrophenolate;dihydrate has a molecular weight of 197.12 g/mol, XLogP of -3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-nitrophenolate;dihydrate is sourced from PubChem (CID 2735104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).