About (4-nitrophenyl)thallium
(4-nitrophenyl)thallium (PubChem CID 88798953) has the molecular formula C6H4NO2Tl
and a molecular weight of 326.49 g/mol. Its IUPAC name is (4-nitrophenyl)thallium.
Molecular Properties
| Compound Name | (4-nitrophenyl)thallium |
| PubChem CID | 88798953 |
| Molecular Formula | C6H4NO2Tl |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | (4-nitrophenyl)thallium |
| SMILES | O=[N+]([O-])c1ccc([Tl])cc1 |
| InChI | InChI=1S/C6H4NO2.Tl/c8-7(9)6-4-2-1-3-5-6;/h2-5H; |
| InChIKey | BDWPSYFUCWVIKD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)thallium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)thallium?
The IUPAC name of (4-nitrophenyl)thallium (CID 88798953) is (4-nitrophenyl)thallium.
What is the SMILES notation for (4-nitrophenyl)thallium?
The canonical SMILES for (4-nitrophenyl)thallium is O=[N+]([O-])c1ccc([Tl])cc1.
What is the InChIKey of (4-nitrophenyl)thallium?
The InChIKey is BDWPSYFUCWVIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4NO2.Tl/c8-7(9)6-4-2-1-3-5-6;/h2-5H;.
What are the key properties of (4-nitrophenyl)thallium?
(4-nitrophenyl)thallium has a molecular weight of 326.49 g/mol, XLogP of 0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)thallium is sourced from PubChem (CID 88798953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).