About butane;pyridin-3-yl carbamate
butane;pyridin-3-yl carbamate (PubChem CID 69137647) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is butane;pyridin-3-yl carbamate.
Molecular Properties
| Compound Name | butane;pyridin-3-yl carbamate |
| PubChem CID | 69137647 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | butane;pyridin-3-yl carbamate |
| SMILES | CCCC.NC(=O)Oc1cccnc1 |
| InChI | InChI=1S/C6H6N2O2.C4H10/c7-6(9)10-5-2-1-3-8-4-5;1-3-4-2/h1-4H,(H2,7,9);3-4H2,1-2H3 |
| InChIKey | BWTQUYMUABNBLE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane;pyridin-3-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;pyridin-3-yl carbamate?
The IUPAC name of butane;pyridin-3-yl carbamate (CID 69137647) is butane;pyridin-3-yl carbamate.
What is the SMILES notation for butane;pyridin-3-yl carbamate?
The canonical SMILES for butane;pyridin-3-yl carbamate is CCCC.NC(=O)Oc1cccnc1.
What is the InChIKey of butane;pyridin-3-yl carbamate?
The InChIKey is BWTQUYMUABNBLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.C4H10/c7-6(9)10-5-2-1-3-8-4-5;1-3-4-2/h1-4H,(H2,7,9);3-4H2,1-2H3.
What are the key properties of butane;pyridin-3-yl carbamate?
butane;pyridin-3-yl carbamate has a molecular weight of 196.25 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;pyridin-3-yl carbamate is sourced from PubChem (CID 69137647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).