About pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride
pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride (PubChem CID 3027934) has the molecular formula C16H29Cl2N3O2
and a molecular weight of 366.33 g/mol. Its IUPAC name is pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride.
Molecular Properties
| Compound Name | pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride |
| PubChem CID | 3027934 |
| Molecular Formula | C16H29Cl2N3O2 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride |
| SMILES | CCCCCCCN(CN(C)C)C(=O)Oc1cccnc1.Cl.Cl |
| InChI | InChI=1S/C16H27N3O2.2ClH/c1-4-5-6-7-8-12-19(14-18(2)3)16(20)21-15-10-9-11-17-13-15;;/h9-11,13H,4-8,12,14H2,1-3H3;2*1H |
| InChIKey | NFCOBLWOJYCXQX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride?
The IUPAC name of pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride (CID 3027934) is pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride.
What is the SMILES notation for pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride?
The canonical SMILES for pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride is CCCCCCCN(CN(C)C)C(=O)Oc1cccnc1.Cl.Cl.
What is the InChIKey of pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride?
The InChIKey is NFCOBLWOJYCXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O2.2ClH/c1-4-5-6-7-8-12-19(14-18(2)3)16(20)21-15-10-9-11-17-13-15;;/h9-11,13H,4-8,12,14H2,1-3H3;2*1H.
What are the key properties of pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride?
pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride has a molecular weight of 366.33 g/mol, XLogP of 4.22, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl N-[(dimethylamino)methyl]-N-heptylcarbamate;dihydrochloride is sourced from PubChem (CID 3027934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).