C24H37NO6 — CID 3014184
pyridin-3-yl 4,5-bis(acetyloxymethyl)-2-methyldodecanoate (PubChem CID 3014184) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is pyridin-3-yl 4,5-bis(acetyloxymethyl)-2-methyldodecanoate.
| Compound Name | pyridin-3-yl 4,5-bis(acetyloxymethyl)-2-methyldodecanoate |
|---|---|
| PubChem CID | 3014184 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | pyridin-3-yl 4,5-bis(acetyloxymethyl)-2-methyldodecanoate |
| SMILES | CCCCCCCC(COC(C)=O)C(COC(C)=O)CC(C)C(=O)Oc1cccnc1 |
| InChI | InChI=1S/C24H37NO6/c1-5-6-7-8-9-11-21(16-29-19(3)26)22(17-30-20(4)27)14-18(2)24(28)31-23-12-10-13-25-15-23/h10,12-13,15,18,21-22H,5-9,11,14,16-17H2,1-4H3 |
| InChIKey | ZBGMPHUNGYAZDI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|