About anisole;2-nitroprop-1-ene
anisole;2-nitroprop-1-ene (PubChem CID 174270920) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is anisole;2-nitroprop-1-ene.
Molecular Properties
| Compound Name | anisole;2-nitroprop-1-ene |
| PubChem CID | 174270920 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | anisole;2-nitroprop-1-ene |
| SMILES | C=C(C)[N+](=O)[O-].COc1ccccc1 |
| InChI | InChI=1S/C7H8O.C3H5NO2/c1-8-7-5-3-2-4-6-7;1-3(2)4(5)6/h2-6H,1H3;1H2,2H3 |
| InChIKey | ZMJRITBPGUSNMA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze anisole;2-nitroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;2-nitroprop-1-ene?
The IUPAC name of anisole;2-nitroprop-1-ene (CID 174270920) is anisole;2-nitroprop-1-ene.
What is the SMILES notation for anisole;2-nitroprop-1-ene?
The canonical SMILES for anisole;2-nitroprop-1-ene is C=C(C)[N+](=O)[O-].COc1ccccc1.
What is the InChIKey of anisole;2-nitroprop-1-ene?
The InChIKey is ZMJRITBPGUSNMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C3H5NO2/c1-8-7-5-3-2-4-6-7;1-3(2)4(5)6/h2-6H,1H3;1H2,2H3.
What are the key properties of anisole;2-nitroprop-1-ene?
anisole;2-nitroprop-1-ene has a molecular weight of 195.22 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;2-nitroprop-1-ene is sourced from PubChem (CID 174270920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).