About anisole;molecular nitrogen;sulfuric acid
anisole;molecular nitrogen;sulfuric acid (PubChem CID 174681459) has the molecular formula C7H10N2O5S
and a molecular weight of 234.23 g/mol. Its IUPAC name is anisole;molecular nitrogen;sulfuric acid.
Molecular Properties
| Compound Name | anisole;molecular nitrogen;sulfuric acid |
| PubChem CID | 174681459 |
| Molecular Formula | C7H10N2O5S |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | anisole;molecular nitrogen;sulfuric acid |
| SMILES | COc1ccccc1.N#N.O=S(=O)(O)O |
| InChI | InChI=1S/C7H8O.N2.H2O4S/c1-8-7-5-3-2-4-6-7;1-2;1-5(2,3)4/h2-6H,1H3;;(H2,1,2,3,4) |
| InChIKey | NDISBKOMTCFVEL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze anisole;molecular nitrogen;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;molecular nitrogen;sulfuric acid?
The IUPAC name of anisole;molecular nitrogen;sulfuric acid (CID 174681459) is anisole;molecular nitrogen;sulfuric acid.
What is the SMILES notation for anisole;molecular nitrogen;sulfuric acid?
The canonical SMILES for anisole;molecular nitrogen;sulfuric acid is COc1ccccc1.N#N.O=S(=O)(O)O.
What is the InChIKey of anisole;molecular nitrogen;sulfuric acid?
The InChIKey is NDISBKOMTCFVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.N2.H2O4S/c1-8-7-5-3-2-4-6-7;1-2;1-5(2,3)4/h2-6H,1H3;;(H2,1,2,3,4).
What are the key properties of anisole;molecular nitrogen;sulfuric acid?
anisole;molecular nitrogen;sulfuric acid has a molecular weight of 234.23 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;molecular nitrogen;sulfuric acid is sourced from PubChem (CID 174681459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).