About azane;phenoxybenzene;sulfuric acid
azane;phenoxybenzene;sulfuric acid (PubChem CID 66973780) has the molecular formula C12H15NO5S
and a molecular weight of 285.32 g/mol. Its IUPAC name is azane;phenoxybenzene;sulfuric acid.
Molecular Properties
| Compound Name | azane;phenoxybenzene;sulfuric acid |
| PubChem CID | 66973780 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | azane;phenoxybenzene;sulfuric acid |
| SMILES | N.O=S(=O)(O)O.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.H3N.H2O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;1-5(2,3)4/h1-10H;1H3;(H2,1,2,3,4) |
| InChIKey | BBDGRIXEVKTFNM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;phenoxybenzene;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;phenoxybenzene;sulfuric acid?
The IUPAC name of azane;phenoxybenzene;sulfuric acid (CID 66973780) is azane;phenoxybenzene;sulfuric acid.
What is the SMILES notation for azane;phenoxybenzene;sulfuric acid?
The canonical SMILES for azane;phenoxybenzene;sulfuric acid is N.O=S(=O)(O)O.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of azane;phenoxybenzene;sulfuric acid?
The InChIKey is BBDGRIXEVKTFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.H3N.H2O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;1-5(2,3)4/h1-10H;1H3;(H2,1,2,3,4).
What are the key properties of azane;phenoxybenzene;sulfuric acid?
azane;phenoxybenzene;sulfuric acid has a molecular weight of 285.32 g/mol, XLogP of 2.99, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;phenoxybenzene;sulfuric acid is sourced from PubChem (CID 66973780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).