C12H16O2 — CID 157443112
methanol;3-methylbuta-1,3-dien-2-yloxybenzene (PubChem CID 157443112) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is methanol;3-methylbuta-1,3-dien-2-yloxybenzene.
| Compound Name | methanol;3-methylbuta-1,3-dien-2-yloxybenzene |
|---|---|
| PubChem CID | 157443112 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | methanol;3-methylbuta-1,3-dien-2-yloxybenzene |
| SMILES | C=C(C)C(=C)Oc1ccccc1.CO |
| InChI | InChI=1S/C11H12O.CH4O/c1-9(2)10(3)12-11-7-5-4-6-8-11;1-2/h4-8H,1,3H2,2H3;2H,1H3 |
| InChIKey | BRXDWZYQSRZDTE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|