About methyl 2-phenoxyprop-2-enoate;toluene
methyl 2-phenoxyprop-2-enoate;toluene (PubChem CID 174856414) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 2-phenoxyprop-2-enoate;toluene.
Molecular Properties
| Compound Name | methyl 2-phenoxyprop-2-enoate;toluene |
| PubChem CID | 174856414 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | methyl 2-phenoxyprop-2-enoate;toluene |
| SMILES | C=C(Oc1ccccc1)C(=O)OC.Cc1ccccc1 |
| InChI | InChI=1S/C10H10O3.C7H8/c1-8(10(11)12-2)13-9-6-4-3-5-7-9;1-7-5-3-2-4-6-7/h3-7H,1H2,2H3;2-6H,1H3 |
| InChIKey | OIHHBEBCKFXYLN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-phenoxyprop-2-enoate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phenoxyprop-2-enoate;toluene?
The IUPAC name of methyl 2-phenoxyprop-2-enoate;toluene (CID 174856414) is methyl 2-phenoxyprop-2-enoate;toluene.
What is the SMILES notation for methyl 2-phenoxyprop-2-enoate;toluene?
The canonical SMILES for methyl 2-phenoxyprop-2-enoate;toluene is C=C(Oc1ccccc1)C(=O)OC.Cc1ccccc1.
What is the InChIKey of methyl 2-phenoxyprop-2-enoate;toluene?
The InChIKey is OIHHBEBCKFXYLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3.C7H8/c1-8(10(11)12-2)13-9-6-4-3-5-7-9;1-7-5-3-2-4-6-7/h3-7H,1H2,2H3;2-6H,1H3.
What are the key properties of methyl 2-phenoxyprop-2-enoate;toluene?
methyl 2-phenoxyprop-2-enoate;toluene has a molecular weight of 270.33 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenoxyprop-2-enoate;toluene is sourced from PubChem (CID 174856414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).